C8H12N4O — CID 43374025
2-[(6-amino-3-pyridinyl)-methylamino]acetamide (PubChem CID 43374025) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)-methylamino]acetamide.
| Compound Name | 2-[(6-amino-3-pyridinyl)-methylamino]acetamide |
|---|---|
| PubChem CID | 43374025 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)-methylamino]acetamide |
| SMILES | CN(CC(N)=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C8H12N4O/c1-12(5-8(10)13)6-2-3-7(9)11-4-6/h2-4H,5H2,1H3,(H2,9,11)(H2,10,13) |
| InChIKey | VPUJDZAFWGWGBQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |