C10H17N3 — CID 43265505
2-N-ethyl-2-N-propan-2-ylpyridine-2,5-diamine (PubChem CID 43265505) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-N-ethyl-2-N-propan-2-ylpyridine-2,5-diamine.
| Compound Name | 2-N-ethyl-2-N-propan-2-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 43265505 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-N-ethyl-2-N-propan-2-ylpyridine-2,5-diamine |
| SMILES | CCN(c1ccc(N)cn1)C(C)C |
| InChI | InChI=1S/C10H17N3/c1-4-13(8(2)3)10-6-5-9(11)7-12-10/h5-8H,4,11H2,1-3H3 |
| InChIKey | YKWMVUNKDCEWNF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |