C15H23NO2 — CID 170279439
2-methoxy-N,4-dimethyl-N-(oxan-4-ylmethyl)aniline (PubChem CID 170279439) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-methoxy-N,4-dimethyl-N-(oxan-4-ylmethyl)aniline.
| Compound Name | 2-methoxy-N,4-dimethyl-N-(oxan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 170279439 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-methoxy-N,4-dimethyl-N-(oxan-4-ylmethyl)aniline |
| SMILES | COc1cc(C)ccc1N(C)CC1CCOCC1 |
| InChI | InChI=1S/C15H23NO2/c1-12-4-5-14(15(10-12)17-3)16(2)11-13-6-8-18-9-7-13/h4-5,10,13H,6-9,11H2,1-3H3 |
| InChIKey | RWTHXDDDQBDICM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |