C13H21NO4 — CID 115122024
3-(4,5-dimethoxy-N,2-dimethylanilino)propane-1,2-diol (PubChem CID 115122024) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-N,2-dimethylanilino)propane-1,2-diol.
| Compound Name | 3-(4,5-dimethoxy-N,2-dimethylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 115122024 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-(4,5-dimethoxy-N,2-dimethylanilino)propane-1,2-diol |
| SMILES | COc1cc(C)c(N(C)CC(O)CO)cc1OC |
| InChI | InChI=1S/C13H21NO4/c1-9-5-12(17-3)13(18-4)6-11(9)14(2)7-10(16)8-15/h5-6,10,15-16H,7-8H2,1-4H3 |
| InChIKey | NGCJBMIIZQVHCJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|