C13H22N2O4 — CID 83001363
1-(2-amino-4,5-dimethoxy-N-methylanilino)-3-methoxypropan-2-ol (PubChem CID 83001363) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(2-amino-4,5-dimethoxy-N-methylanilino)-3-methoxypropan-2-ol.
| Compound Name | 1-(2-amino-4,5-dimethoxy-N-methylanilino)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 83001363 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(2-amino-4,5-dimethoxy-N-methylanilino)-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C13H22N2O4/c1-15(7-9(16)8-17-2)11-6-13(19-4)12(18-3)5-10(11)14/h5-6,9,16H,7-8,14H2,1-4H3 |
| InChIKey | JLAYSIQABNMIHC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|