About 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol
1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol (PubChem CID 103361844) has the molecular formula C8H15N3O2S
and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol |
| PubChem CID | 103361844 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1cc(N)ns1 |
| InChI | InChI=1S/C8H15N3O2S/c1-11(4-6(12)5-13-2)8-3-7(9)10-14-8/h3,6,12H,4-5H2,1-2H3,(H2,9,10) |
| InChIKey | OIORDGDORNQZNR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol (CID 103361844) is 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol is COCC(O)CN(C)c1cc(N)ns1.
What is the InChIKey of 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol?
The InChIKey is OIORDGDORNQZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2S/c1-11(4-6(12)5-13-2)8-3-7(9)10-14-8/h3,6,12H,4-5H2,1-2H3,(H2,9,10).
What are the key properties of 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol?
1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol has a molecular weight of 217.29 g/mol, XLogP of 0.17, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-amino-1,2-thiazol-5-yl)-methylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 103361844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).