C13H22N2O2 — CID 114281243
1-(2-amino-N,4,5-trimethylanilino)-3-methoxypropan-2-ol (PubChem CID 114281243) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(2-amino-N,4,5-trimethylanilino)-3-methoxypropan-2-ol.
| Compound Name | 1-(2-amino-N,4,5-trimethylanilino)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 114281243 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(2-amino-N,4,5-trimethylanilino)-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1cc(C)c(C)cc1N |
| InChI | InChI=1S/C13H22N2O2/c1-9-5-12(14)13(6-10(9)2)15(3)7-11(16)8-17-4/h5-6,11,16H,7-8,14H2,1-4H3 |
| InChIKey | NCPJDNZVVLATEJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|