C12H20N2O3 — CID 113392602
1-(2-amino-3-methoxy-N-methylanilino)-3-methoxypropan-2-ol (PubChem CID 113392602) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-(2-amino-3-methoxy-N-methylanilino)-3-methoxypropan-2-ol.
| Compound Name | 1-(2-amino-3-methoxy-N-methylanilino)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 113392602 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-(2-amino-3-methoxy-N-methylanilino)-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1cccc(OC)c1N |
| InChI | InChI=1S/C12H20N2O3/c1-14(7-9(15)8-16-2)10-5-4-6-11(17-3)12(10)13/h4-6,9,15H,7-8,13H2,1-3H3 |
| InChIKey | GSJFQBPQPMBVIX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|