C10H9BrF2O — CID 170497383
4-(4-bromobut-1-enyl)-3,5-difluorophenol (PubChem CID 170497383) has the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. Its IUPAC name is 4-(4-bromobut-1-enyl)-3,5-difluorophenol.
| Compound Name | 4-(4-bromobut-1-enyl)-3,5-difluorophenol |
|---|---|
| PubChem CID | 170497383 |
| Molecular Formula | C10H9BrF2O |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 4-(4-bromobut-1-enyl)-3,5-difluorophenol |
| SMILES | Oc1cc(F)c(C=CCCBr)c(F)c1 |
| InChI | InChI=1S/C10H9BrF2O/c11-4-2-1-3-8-9(12)5-7(14)6-10(8)13/h1,3,5-6,14H,2,4H2 |
| InChIKey | NYVFLKSHPSNTAI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|