C10H9BrF2 — CID 82086369
1-[(E)-4-bromobut-1-enyl]-3,5-difluorobenzene (PubChem CID 82086369) has the molecular formula C10H9BrF2 and a molecular weight of 247.08 g/mol. Its IUPAC name is 1-[(E)-4-bromobut-1-enyl]-3,5-difluorobenzene.
| Compound Name | 1-[(E)-4-bromobut-1-enyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 82086369 |
| Molecular Formula | C10H9BrF2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 1-[(E)-4-bromobut-1-enyl]-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(/C=C/CCBr)c1 |
| InChI | InChI=1S/C10H9BrF2/c11-4-2-1-3-8-5-9(12)7-10(13)6-8/h1,3,5-7H,2,4H2/b3-1+ |
| InChIKey | ZHZLZFJFGCJUHQ-HNQUOIGGSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|