C10H12BrFN2 — CID 170497391
3-(4-bromobut-1-enyl)-5-fluorobenzene-1,2-diamine (PubChem CID 170497391) has the molecular formula C10H12BrFN2 and a molecular weight of 259.12 g/mol. Its IUPAC name is 3-(4-bromobut-1-enyl)-5-fluorobenzene-1,2-diamine.
| Compound Name | 3-(4-bromobut-1-enyl)-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 170497391 |
| Molecular Formula | C10H12BrFN2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 3-(4-bromobut-1-enyl)-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)cc(C=CCCBr)c1N |
| InChI | InChI=1S/C10H12BrFN2/c11-4-2-1-3-7-5-8(12)6-9(13)10(7)14/h1,3,5-6H,2,4,13-14H2 |
| InChIKey | RQKALQRYESZSFD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|