C9H9F2NS — CID 169455202
3-(2-amino-3,5-difluorophenyl)prop-2-ene-1-thiol (PubChem CID 169455202) has the molecular formula C9H9F2NS and a molecular weight of 201.24 g/mol. Its IUPAC name is 3-(2-amino-3,5-difluorophenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(2-amino-3,5-difluorophenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169455202 |
| Molecular Formula | C9H9F2NS |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3-(2-amino-3,5-difluorophenyl)prop-2-ene-1-thiol |
| SMILES | Nc1c(F)cc(F)cc1C=CCS |
| InChI | InChI=1S/C9H9F2NS/c10-7-4-6(2-1-3-13)9(12)8(11)5-7/h1-2,4-5,13H,3,12H2 |
| InChIKey | HKKGJASFNADGMS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|