C9H7BrF2S — CID 169456240
3-(4-bromo-2,5-difluorophenyl)prop-2-ene-1-thiol (PubChem CID 169456240) has the molecular formula C9H7BrF2S and a molecular weight of 265.12 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluorophenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(4-bromo-2,5-difluorophenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169456240 |
| Molecular Formula | C9H7BrF2S |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | 3-(4-bromo-2,5-difluorophenyl)prop-2-ene-1-thiol |
| SMILES | Fc1cc(C=CCS)c(F)cc1Br |
| InChI | InChI=1S/C9H7BrF2S/c10-7-5-8(11)6(2-1-3-13)4-9(7)12/h1-2,4-5,13H,3H2 |
| InChIKey | IJBOVGUGDWBQQQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|