About 4-(4-bromo-2,5-difluorophenyl)but-3-enamide
4-(4-bromo-2,5-difluorophenyl)but-3-enamide (PubChem CID 170798989) has the molecular formula C10H8BrF2NO
and a molecular weight of 276.08 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluorophenyl)but-3-enamide.
Molecular Properties
| Compound Name | 4-(4-bromo-2,5-difluorophenyl)but-3-enamide |
| PubChem CID | 170798989 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 4-(4-bromo-2,5-difluorophenyl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H8BrF2NO/c11-7-5-8(12)6(4-9(7)13)2-1-3-10(14)15/h1-2,4-5H,3H2,(H2,14,15) |
| InChIKey | XNLRDUNLRWMNJR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromo-2,5-difluorophenyl)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-2,5-difluorophenyl)but-3-enamide?
The IUPAC name of 4-(4-bromo-2,5-difluorophenyl)but-3-enamide (CID 170798989) is 4-(4-bromo-2,5-difluorophenyl)but-3-enamide.
What is the SMILES notation for 4-(4-bromo-2,5-difluorophenyl)but-3-enamide?
The canonical SMILES for 4-(4-bromo-2,5-difluorophenyl)but-3-enamide is NC(=O)CC=Cc1cc(F)c(Br)cc1F.
What is the InChIKey of 4-(4-bromo-2,5-difluorophenyl)but-3-enamide?
The InChIKey is XNLRDUNLRWMNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF2NO/c11-7-5-8(12)6(4-9(7)13)2-1-3-10(14)15/h1-2,4-5H,3H2,(H2,14,15).
What are the key properties of 4-(4-bromo-2,5-difluorophenyl)but-3-enamide?
4-(4-bromo-2,5-difluorophenyl)but-3-enamide has a molecular weight of 276.08 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-2,5-difluorophenyl)but-3-enamide is sourced from PubChem (CID 170798989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).