C10H8BrF2NO — CID 170798989
4-(4-bromo-2,5-difluorophenyl)but-3-enamide (PubChem CID 170798989) has the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluorophenyl)but-3-enamide.
| Compound Name | 4-(4-bromo-2,5-difluorophenyl)but-3-enamide |
|---|---|
| PubChem CID | 170798989 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 4-(4-bromo-2,5-difluorophenyl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H8BrF2NO/c11-7-5-8(12)6(4-9(7)13)2-1-3-10(14)15/h1-2,4-5H,3H2,(H2,14,15) |
| InChIKey | XNLRDUNLRWMNJR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|