C13H13F2NO2 — CID 170488999
N-[4-(2,5-difluoro-4-formylphenyl)but-3-enyl]acetamide (PubChem CID 170488999) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is N-[4-(2,5-difluoro-4-formylphenyl)but-3-enyl]acetamide.
| Compound Name | N-[4-(2,5-difluoro-4-formylphenyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170488999 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N-[4-(2,5-difluoro-4-formylphenyl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cc(F)c(C=O)cc1F |
| InChI | InChI=1S/C13H13F2NO2/c1-9(18)16-5-3-2-4-10-6-13(15)11(8-17)7-12(10)14/h2,4,6-8H,3,5H2,1H3,(H,16,18) |
| InChIKey | SSENSQJCEXYRFC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|