C12H12BrF2NO — CID 170489764
N-[4-(4-bromo-3,5-difluorophenyl)but-3-enyl]acetamide (PubChem CID 170489764) has the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. Its IUPAC name is N-[4-(4-bromo-3,5-difluorophenyl)but-3-enyl]acetamide.
| Compound Name | N-[4-(4-bromo-3,5-difluorophenyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489764 |
| Molecular Formula | C12H12BrF2NO |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-[4-(4-bromo-3,5-difluorophenyl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C12H12BrF2NO/c1-8(17)16-5-3-2-4-9-6-10(14)12(13)11(15)7-9/h2,4,6-7H,3,5H2,1H3,(H,16,17) |
| InChIKey | JDAKLYYRBUISSD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|