C13H12F2N2O — CID 170489069
N-[4-(4-cyano-3,5-difluorophenyl)but-3-enyl]acetamide (PubChem CID 170489069) has the molecular formula C13H12F2N2O and a molecular weight of 250.25 g/mol. Its IUPAC name is N-[4-(4-cyano-3,5-difluorophenyl)but-3-enyl]acetamide.
| Compound Name | N-[4-(4-cyano-3,5-difluorophenyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489069 |
| Molecular Formula | C13H12F2N2O |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-[4-(4-cyano-3,5-difluorophenyl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C13H12F2N2O/c1-9(18)17-5-3-2-4-10-6-12(14)11(8-16)13(15)7-10/h2,4,6-7H,3,5H2,1H3,(H,17,18) |
| InChIKey | NGBXOPIWCAQCQO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|