C12H13FN2O3 — CID 170489087
N-[4-(2-fluoro-5-nitrophenyl)but-3-enyl]acetamide (PubChem CID 170489087) has the molecular formula C12H13FN2O3 and a molecular weight of 252.25 g/mol. Its IUPAC name is N-[4-(2-fluoro-5-nitrophenyl)but-3-enyl]acetamide.
| Compound Name | N-[4-(2-fluoro-5-nitrophenyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489087 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-[4-(2-fluoro-5-nitrophenyl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C12H13FN2O3/c1-9(16)14-7-3-2-4-10-8-11(15(17)18)5-6-12(10)13/h2,4-6,8H,3,7H2,1H3,(H,14,16) |
| InChIKey | IHJVUOPVDBKBSO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|