C13H14N2O4 — CID 170489364
N-[4-(3-formyl-5-nitrophenyl)but-3-enyl]acetamide (PubChem CID 170489364) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[4-(3-formyl-5-nitrophenyl)but-3-enyl]acetamide.
| Compound Name | N-[4-(3-formyl-5-nitrophenyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489364 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[4-(3-formyl-5-nitrophenyl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cc(C=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N2O4/c1-10(17)14-5-3-2-4-11-6-12(9-16)8-13(7-11)15(18)19/h2,4,6-9H,3,5H2,1H3,(H,14,17) |
| InChIKey | JGOLZBGETIMIAS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|