C10H7BrF2O — CID 169475773
4-(3-bromoprop-1-enyl)-2,5-difluorobenzaldehyde (PubChem CID 169475773) has the molecular formula C10H7BrF2O and a molecular weight of 261.07 g/mol. Its IUPAC name is 4-(3-bromoprop-1-enyl)-2,5-difluorobenzaldehyde.
| Compound Name | 4-(3-bromoprop-1-enyl)-2,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 169475773 |
| Molecular Formula | C10H7BrF2O |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 4-(3-bromoprop-1-enyl)-2,5-difluorobenzaldehyde |
| SMILES | O=Cc1cc(F)c(C=CCBr)cc1F |
| InChI | InChI=1S/C10H7BrF2O/c11-3-1-2-7-4-10(13)8(6-14)5-9(7)12/h1-2,4-6H,3H2 |
| InChIKey | VVWFGNYDTSJOAQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|