C11H11F3O — CID 67120113
5-(2,4,5-trifluorophenyl)pent-4-en-2-ol (PubChem CID 67120113) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is 5-(2,4,5-trifluorophenyl)pent-4-en-2-ol.
| Compound Name | 5-(2,4,5-trifluorophenyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 67120113 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 5-(2,4,5-trifluorophenyl)pent-4-en-2-ol |
| SMILES | CC(O)CC=Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H11F3O/c1-7(15)3-2-4-8-5-10(13)11(14)6-9(8)12/h2,4-7,15H,3H2,1H3 |
| InChIKey | XVCAUIJAQHLRRX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|