C12H15F2N — CID 117301557
(E)-3-(2,4-difluoro-5-propan-2-ylphenyl)prop-2-en-1-amine (PubChem CID 117301557) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is (E)-3-(2,4-difluoro-5-propan-2-ylphenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(2,4-difluoro-5-propan-2-ylphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117301557 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (E)-3-(2,4-difluoro-5-propan-2-ylphenyl)prop-2-en-1-amine |
| SMILES | CC(C)c1cc(/C=C/CN)c(F)cc1F |
| InChI | InChI=1S/C12H15F2N/c1-8(2)10-6-9(4-3-5-15)11(13)7-12(10)14/h3-4,6-8H,5,15H2,1-2H3/b4-3+ |
| InChIKey | UVMCSPVDDRGHQA-ONEGZZNKSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |