C9H4Br2FN — CID 169484391
3-(2,6-dibromo-4-fluorophenyl)prop-2-enenitrile (PubChem CID 169484391) has the molecular formula C9H4Br2FN and a molecular weight of 304.94 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-fluorophenyl)prop-2-enenitrile.
| Compound Name | 3-(2,6-dibromo-4-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169484391 |
| Molecular Formula | C9H4Br2FN |
| Molecular Weight | 304.94 g/mol |
| Exact Mass | 302.87 |
| IUPAC Name | 3-(2,6-dibromo-4-fluorophenyl)prop-2-enenitrile |
| SMILES | N#CC=Cc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C9H4Br2FN/c10-8-4-6(12)5-9(11)7(8)2-1-3-13/h1-2,4-5H |
| InChIKey | OCWBDGVNEGJIBN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|