C11H13BrO — CID 170477579
4-(2-bromo-4-methylphenyl)but-3-en-1-ol (PubChem CID 170477579) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenyl)but-3-en-1-ol.
| Compound Name | 4-(2-bromo-4-methylphenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170477579 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 4-(2-bromo-4-methylphenyl)but-3-en-1-ol |
| SMILES | Cc1ccc(C=CCCO)c(Br)c1 |
| InChI | InChI=1S/C11H13BrO/c1-9-5-6-10(11(12)8-9)4-2-3-7-13/h2,4-6,8,13H,3,7H2,1H3 |
| InChIKey | QPGDWBZPPWYMFF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |