C8H5Br2O3- — CID 21183264
3,5-dibromo-4-(hydroxymethyl)benzoate (PubChem CID 21183264) has the molecular formula C8H5Br2O3- and a molecular weight of 308.93 g/mol. Its IUPAC name is 3,5-dibromo-4-(hydroxymethyl)benzoate.
| Compound Name | 3,5-dibromo-4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 21183264 |
| Molecular Formula | C8H5Br2O3- |
| Molecular Weight | 308.93 g/mol |
| Exact Mass | 306.86 |
| IUPAC Name | 3,5-dibromo-4-(hydroxymethyl)benzoate |
| SMILES | O=C([O-])c1cc(Br)c(CO)c(Br)c1 |
| InChI | InChI=1S/C8H6Br2O3/c9-6-1-4(8(12)13)2-7(10)5(6)3-11/h1-2,11H,3H2,(H,12,13)/p-1 |
| InChIKey | MEZFXXYLDUEBQT-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.93 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |