C14H8Br2FO3- — CID 8707071
3,5-dibromo-4-[(2-fluorophenyl)methoxy]benzoate (PubChem CID 8707071) has the molecular formula C14H8Br2FO3- and a molecular weight of 403.02 g/mol. Its IUPAC name is 3,5-dibromo-4-[(2-fluorophenyl)methoxy]benzoate.
| Compound Name | 3,5-dibromo-4-[(2-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 8707071 |
| Molecular Formula | C14H8Br2FO3- |
| Molecular Weight | 403.02 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 3,5-dibromo-4-[(2-fluorophenyl)methoxy]benzoate |
| SMILES | O=C([O-])c1cc(Br)c(OCc2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C14H9Br2FO3/c15-10-5-9(14(18)19)6-11(16)13(10)20-7-8-3-1-2-4-12(8)17/h1-6H,7H2,(H,18,19)/p-1 |
| InChIKey | BPMFLPDHGSVYIA-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.02 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |