C9H7BrF2 — CID 176770194
1-bromo-3,5-difluoro-2-prop-2-enylbenzene (PubChem CID 176770194) has the molecular formula C9H7BrF2 and a molecular weight of 233.05 g/mol. Its IUPAC name is 1-bromo-3,5-difluoro-2-prop-2-enylbenzene.
| Compound Name | 1-bromo-3,5-difluoro-2-prop-2-enylbenzene |
|---|---|
| PubChem CID | 176770194 |
| Molecular Formula | C9H7BrF2 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 1-bromo-3,5-difluoro-2-prop-2-enylbenzene |
| SMILES | C=CCc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C9H7BrF2/c1-2-3-7-8(10)4-6(11)5-9(7)12/h2,4-5H,1,3H2 |
| InChIKey | ZXOUIZSWYMZMEQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|