C11H11BrF2O — CID 118308830
1-bromo-3,5-difluoro-2-[(2S)-pent-4-en-2-yl]oxybenzene (PubChem CID 118308830) has the molecular formula C11H11BrF2O and a molecular weight of 277.11 g/mol. Its IUPAC name is 1-bromo-3,5-difluoro-2-[(2S)-pent-4-en-2-yl]oxybenzene.
| Compound Name | 1-bromo-3,5-difluoro-2-[(2S)-pent-4-en-2-yl]oxybenzene |
|---|---|
| PubChem CID | 118308830 |
| Molecular Formula | C11H11BrF2O |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 1-bromo-3,5-difluoro-2-[(2S)-pent-4-en-2-yl]oxybenzene |
| SMILES | C=CC[C@H](C)Oc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H11BrF2O/c1-3-4-7(2)15-11-9(12)5-8(13)6-10(11)14/h3,5-7H,1,4H2,2H3/t7-/m0/s1 |
| InChIKey | VAKPERGJSRWAIU-ZETCQYMHSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|