C8H6Br2F2 — CID 156856263
1-bromo-2-(1-bromoethyl)-3,5-difluorobenzene (PubChem CID 156856263) has the molecular formula C8H6Br2F2 and a molecular weight of 299.94 g/mol. Its IUPAC name is 1-bromo-2-(1-bromoethyl)-3,5-difluorobenzene.
| Compound Name | 1-bromo-2-(1-bromoethyl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 156856263 |
| Molecular Formula | C8H6Br2F2 |
| Molecular Weight | 299.94 g/mol |
| Exact Mass | 297.88 |
| IUPAC Name | 1-bromo-2-(1-bromoethyl)-3,5-difluorobenzene |
| SMILES | CC(Br)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H6Br2F2/c1-4(9)8-6(10)2-5(11)3-7(8)12/h2-4H,1H3 |
| InChIKey | UOVZJGUYXSXTIA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.94 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|