C7H5BrF2O — CID 102571531
1-bromo-3,5-difluoro-2-(trideuteriomethoxy)benzene (PubChem CID 102571531) has the molecular formula C7H5BrF2O and a molecular weight of 226.03 g/mol. Its IUPAC name is 1-bromo-3,5-difluoro-2-(trideuteriomethoxy)benzene.
| Compound Name | 1-bromo-3,5-difluoro-2-(trideuteriomethoxy)benzene |
|---|---|
| PubChem CID | 102571531 |
| Molecular Formula | C7H5BrF2O |
| Molecular Weight | 226.03 g/mol |
| Exact Mass | 224.97 |
| IUPAC Name | 1-bromo-3,5-difluoro-2-(trideuteriomethoxy)benzene |
| SMILES | [2H]C([2H])([2H])Oc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C7H5BrF2O/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3H,1H3/i1D3 |
| InChIKey | MFXWQGHKLXJIIP-FIBGUPNXSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.03 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |