C7H2Br2F4O — CID 118813366
1,3-dibromo-5-fluoro-2-(trifluoromethoxy)benzene (PubChem CID 118813366) has the molecular formula C7H2Br2F4O and a molecular weight of 337.89 g/mol. Its IUPAC name is 1,3-dibromo-5-fluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-dibromo-5-fluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118813366 |
| Molecular Formula | C7H2Br2F4O |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 335.84 |
| IUPAC Name | 1,3-dibromo-5-fluoro-2-(trifluoromethoxy)benzene |
| SMILES | Fc1cc(Br)c(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C7H2Br2F4O/c8-4-1-3(10)2-5(9)6(4)14-7(11,12)13/h1-2H |
| InChIKey | SVWCJFGXKMXDAG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |