C6H3BrF4N2O3S — CID 118838899
4-bromo-6-fluoro-5-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 118838899) has the molecular formula C6H3BrF4N2O3S and a molecular weight of 339.06 g/mol. Its IUPAC name is 4-bromo-6-fluoro-5-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 4-bromo-6-fluoro-5-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118838899 |
| Molecular Formula | C6H3BrF4N2O3S |
| Molecular Weight | 339.06 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 4-bromo-6-fluoro-5-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)c(OC(F)(F)F)c(F)n1 |
| InChI | InChI=1S/C6H3BrF4N2O3S/c7-2-1-3(17(12,14)15)13-5(8)4(2)16-6(9,10)11/h1H,(H2,12,14,15) |
| InChIKey | HEXHYRJKEXJJPJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.06 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|