C7H6BrFO3 — CID 84798374
4-bromo-2-fluoro-6-(hydroxymethyl)benzene-1,3-diol (PubChem CID 84798374) has the molecular formula C7H6BrFO3 and a molecular weight of 237.02 g/mol. Its IUPAC name is 4-bromo-2-fluoro-6-(hydroxymethyl)benzene-1,3-diol.
| Compound Name | 4-bromo-2-fluoro-6-(hydroxymethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 84798374 |
| Molecular Formula | C7H6BrFO3 |
| Molecular Weight | 237.02 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | 4-bromo-2-fluoro-6-(hydroxymethyl)benzene-1,3-diol |
| SMILES | OCc1cc(Br)c(O)c(F)c1O |
| InChI | InChI=1S/C7H6BrFO3/c8-4-1-3(2-10)6(11)5(9)7(4)12/h1,10-12H,2H2 |
| InChIKey | NBKHCMYLEBOVQG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |