C7H6BrClO4S — CID 117485801
(5-bromo-2,3-dihydroxyphenyl)methanesulfonyl chloride (PubChem CID 117485801) has the molecular formula C7H6BrClO4S and a molecular weight of 301.55 g/mol. Its IUPAC name is (5-bromo-2,3-dihydroxyphenyl)methanesulfonyl chloride.
| Compound Name | (5-bromo-2,3-dihydroxyphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117485801 |
| Molecular Formula | C7H6BrClO4S |
| Molecular Weight | 301.55 g/mol |
| Exact Mass | 299.89 |
| IUPAC Name | (5-bromo-2,3-dihydroxyphenyl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1cc(Br)cc(O)c1O |
| InChI | InChI=1S/C7H6BrClO4S/c8-5-1-4(3-14(9,12)13)7(11)6(10)2-5/h1-2,10-11H,3H2 |
| InChIKey | WNEDMVJCKPXBBA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|