C7H5ClF2O3S — CID 84801727
(3,4-difluoro-2-hydroxyphenyl)methanesulfonyl chloride (PubChem CID 84801727) has the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. Its IUPAC name is (3,4-difluoro-2-hydroxyphenyl)methanesulfonyl chloride.
| Compound Name | (3,4-difluoro-2-hydroxyphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 84801727 |
| Molecular Formula | C7H5ClF2O3S |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | (3,4-difluoro-2-hydroxyphenyl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1ccc(F)c(F)c1O |
| InChI | InChI=1S/C7H5ClF2O3S/c8-14(12,13)3-4-1-2-5(9)6(10)7(4)11/h1-2,11H,3H2 |
| InChIKey | LEYSAZRDVDSGQD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |