C11H14ClFN2O — CID 102615565
2-[(2-chloro-5-fluorophenyl)methylamino]-N-methylpropanamide (PubChem CID 102615565) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorophenyl)methylamino]-N-methylpropanamide.
| Compound Name | 2-[(2-chloro-5-fluorophenyl)methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 102615565 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[(2-chloro-5-fluorophenyl)methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H14ClFN2O/c1-7(11(16)14-2)15-6-8-5-9(13)3-4-10(8)12/h3-5,7,15H,6H2,1-2H3,(H,14,16) |
| InChIKey | ZEWQRMKWPQHXGF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |