C19H25ClFN3O2 — CID 46249807
2-[3-[(2-chloro-4-fluorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-cycloheptylacetamide (PubChem CID 46249807) has the molecular formula C19H25ClFN3O2 and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-[3-[(2-chloro-4-fluorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-cycloheptylacetamide.
| Compound Name | 2-[3-[(2-chloro-4-fluorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 46249807 |
| Molecular Formula | C19H25ClFN3O2 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[3-[(2-chloro-4-fluorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-cycloheptylacetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(F)cc2Cl)C1=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H25ClFN3O2/c20-17-11-15(21)8-7-14(17)12-23-9-10-24(19(23)26)13-18(25)22-16-5-3-1-2-4-6-16/h7-8,11,16H,1-6,9-10,12-13H2,(H,22,25) |
| InChIKey | DJIUOYSUHYLVJE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |