C18H24FN3O3 — CID 126828936
N-cyclohexyl-2-[[2-(3-fluorophenyl)acetyl]amino]butanediamide (PubChem CID 126828936) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(3-fluorophenyl)acetyl]amino]butanediamide.
| Compound Name | N-cyclohexyl-2-[[2-(3-fluorophenyl)acetyl]amino]butanediamide |
|---|---|
| PubChem CID | 126828936 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-cyclohexyl-2-[[2-(3-fluorophenyl)acetyl]amino]butanediamide |
| SMILES | NC(=O)CC(NC(=O)Cc1cccc(F)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H24FN3O3/c19-13-6-4-5-12(9-13)10-17(24)22-15(11-16(20)23)18(25)21-14-7-2-1-3-8-14/h4-6,9,14-15H,1-3,7-8,10-11H2,(H2,20,23)(H,21,25)(H,22,24) |
| InChIKey | CNDPUCVKAFLKHG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |