C18H21NO5S — CID 177440601
methyl (2R,3S,3aS,7aS)-2-ethenyl-4-(4-methylphenyl)sulfonyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate (PubChem CID 177440601) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl (2R,3S,3aS,7aS)-2-ethenyl-4-(4-methylphenyl)sulfonyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (2R,3S,3aS,7aS)-2-ethenyl-4-(4-methylphenyl)sulfonyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177440601 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl (2R,3S,3aS,7aS)-2-ethenyl-4-(4-methylphenyl)sulfonyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
| SMILES | C=C[C@H]1O[C@H]2C=CCN(S(=O)(=O)c3ccc(C)cc3)[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C18H21NO5S/c1-4-14-16(18(20)23-3)17-15(24-14)6-5-11-19(17)25(21,22)13-9-7-12(2)8-10-13/h4-10,14-17H,1,11H2,2-3H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | LNGUBJSRYWDQTG-YYIAUSFCSA-N |
| XLogP | 1.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|