C26H26F4N2OS — CID 134300329
(2S)-2-[(4-fluorophenyl)sulfanyl-methylamino]-3-methyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]butanamide (PubChem CID 134300329) has the molecular formula C26H26F4N2OS and a molecular weight of 490.57 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)sulfanyl-methylamino]-3-methyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]butanamide.
| Compound Name | (2S)-2-[(4-fluorophenyl)sulfanyl-methylamino]-3-methyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 134300329 |
| Molecular Formula | C26H26F4N2OS |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)sulfanyl-methylamino]-3-methyl-N-[[3-[4-(trifluoromethyl)phenyl]phenyl]methyl]butanamide |
| SMILES | CC(C)[C@@H](C(=O)NCc1cccc(-c2ccc(C(F)(F)F)cc2)c1)N(C)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F4N2OS/c1-17(2)24(32(3)34-23-13-11-22(27)12-14-23)25(33)31-16-18-5-4-6-20(15-18)19-7-9-21(10-8-19)26(28,29)30/h4-15,17,24H,16H2,1-3H3,(H,31,33)/t24-/m0/s1 |
| InChIKey | IZUIDDMZHUHOMC-DEOSSOPVSA-N |
| XLogP | 6.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|