C22H19F4N3OS — CID 134300350
2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]acetamide (PubChem CID 134300350) has the molecular formula C22H19F4N3OS and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 134300350 |
| Molecular Formula | C22H19F4N3OS |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[3-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methyl]acetamide |
| SMILES | CN(CC(=O)NCc1cccc(-c2ccc(C(F)(F)F)cn2)c1)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C22H19F4N3OS/c1-29(31-19-8-6-18(23)7-9-19)14-21(30)28-12-15-3-2-4-16(11-15)20-10-5-17(13-27-20)22(24,25)26/h2-11,13H,12,14H2,1H3,(H,28,30) |
| InChIKey | WSOJXGJAQACIPL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|