C23H20F4N2OS — CID 134300357
2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide (PubChem CID 134300357) has the molecular formula C23H20F4N2OS and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 134300357 |
| Molecular Formula | C23H20F4N2OS |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfanyl-methylamino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20F4N2OS/c1-29(31-21-12-10-20(24)11-13-21)15-22(30)28-14-16-2-4-17(5-3-16)18-6-8-19(9-7-18)23(25,26)27/h2-13H,14-15H2,1H3,(H,28,30) |
| InChIKey | FRWZXMUOAMQDFO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|