C14H17F3N2O2 — CID 146493049
2-[formyl(propan-2-yl)amino]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 146493049) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-[formyl(propan-2-yl)amino]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[formyl(propan-2-yl)amino]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 146493049 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[formyl(propan-2-yl)amino]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC(C)N(C=O)CC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-10(2)19(9-20)8-13(21)18-7-11-3-5-12(6-4-11)14(15,16)17/h3-6,9-10H,7-8H2,1-2H3,(H,18,21) |
| InChIKey | LGHGOPMGXPORCJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|