2-(3,5-diphenylphenyl)acetic acid

C20H16O2 — CID 20542723

IUPAC2-(3,5-diphenylphenyl)acetic acid
SMILESO=C(O)Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1
InChIInChI=1S/C20H16O2/c21-20(22)13-15-11-18(16-7-3-1-4-8-16)14-19(12-15)17-9-5-2-6-10-17/h1-12,14H,13H2,(H,21,22)
InChIKeyRGUXGLXASMIQTF-UHFFFAOYSA-N
MW288.35 g/mol
LogP4.65
Rot. Bonds4

About 2-(3,5-diphenylphenyl)acetic acid

2-(3,5-diphenylphenyl)acetic acid (PubChem CID 20542723) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)acetic acid.

Molecular Properties

Compound Name2-(3,5-diphenylphenyl)acetic acid
PubChem CID20542723
Molecular FormulaC20H16O2
Molecular Weight288.35 g/mol
Exact Mass288.12
IUPAC Name2-(3,5-diphenylphenyl)acetic acid
SMILESO=C(O)Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1
InChIInChI=1S/C20H16O2/c21-20(22)13-15-11-18(16-7-3-1-4-8-16)14-19(12-15)17-9-5-2-6-10-17/h1-12,14H,13H2,(H,21,22)
InChIKeyRGUXGLXASMIQTF-UHFFFAOYSA-N
XLogP4.65
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.35
LogP ≤ 54.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(3,5-diphenylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-diphenylphenyl)acetic acid?
The IUPAC name of 2-(3,5-diphenylphenyl)acetic acid (CID 20542723) is 2-(3,5-diphenylphenyl)acetic acid.
What is the SMILES notation for 2-(3,5-diphenylphenyl)acetic acid?
The canonical SMILES for 2-(3,5-diphenylphenyl)acetic acid is O=C(O)Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1.
What is the InChIKey of 2-(3,5-diphenylphenyl)acetic acid?
The InChIKey is RGUXGLXASMIQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O2/c21-20(22)13-15-11-18(16-7-3-1-4-8-16)14-19(12-15)17-9-5-2-6-10-17/h1-12,14H,13H2,(H,21,22).
What are the key properties of 2-(3,5-diphenylphenyl)acetic acid?
2-(3,5-diphenylphenyl)acetic acid has a molecular weight of 288.35 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-diphenylphenyl)acetic acid is sourced from PubChem (CID 20542723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).