C16H10FNO5 — CID 70232214
6-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluoro-3-hydroxybenzoic acid (PubChem CID 70232214) has the molecular formula C16H10FNO5 and a molecular weight of 315.26 g/mol. Its IUPAC name is 6-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluoro-3-hydroxybenzoic acid.
| Compound Name | 6-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluoro-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 70232214 |
| Molecular Formula | C16H10FNO5 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 6-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluoro-3-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(CN2C(=O)c3ccccc3C2=O)ccc(O)c1F |
| InChI | InChI=1S/C16H10FNO5/c17-13-11(19)6-5-8(12(13)16(22)23)7-18-14(20)9-3-1-2-4-10(9)15(18)21/h1-6,19H,7H2,(H,22,23) |
| InChIKey | PEHWHOYZQHCADJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|