C21H15NO6 — CID 59740424
2-[[4-(2,3-dihydroxyphenyl)-2,3-dihydroxyphenyl]methyl]isoindole-1,3-dione (PubChem CID 59740424) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydroxyphenyl)-2,3-dihydroxyphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(2,3-dihydroxyphenyl)-2,3-dihydroxyphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59740424 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[[4-(2,3-dihydroxyphenyl)-2,3-dihydroxyphenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(-c2cccc(O)c2O)c(O)c1O |
| InChI | InChI=1S/C21H15NO6/c23-16-7-3-6-12(18(16)25)13-9-8-11(17(24)19(13)26)10-22-20(27)14-4-1-2-5-15(14)21(22)28/h1-9,23-26H,10H2 |
| InChIKey | HPDFQIHQCFQOEU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|