C29H29NO3 — CID 75602092
methyl 3-[[3-(3,3-dimethyl-1-phenylbutylidene)-2-oxoindol-1-yl]methyl]benzoate (PubChem CID 75602092) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl 3-[[3-(3,3-dimethyl-1-phenylbutylidene)-2-oxoindol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-(3,3-dimethyl-1-phenylbutylidene)-2-oxoindol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 75602092 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | methyl 3-[[3-(3,3-dimethyl-1-phenylbutylidene)-2-oxoindol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2C(=O)C(=C(CC(C)(C)C)c3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C29H29NO3/c1-29(2,3)18-24(21-12-6-5-7-13-21)26-23-15-8-9-16-25(23)30(27(26)31)19-20-11-10-14-22(17-20)28(32)33-4/h5-17H,18-19H2,1-4H3 |
| InChIKey | PGCXKUWJJJQDFO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|