C30H24N2O5S — CID 76701304
methyl 3-[[2-oxo-3-[phenyl-(4-sulfamoylphenyl)methylidene]indol-1-yl]methyl]benzoate (PubChem CID 76701304) has the molecular formula C30H24N2O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is methyl 3-[[2-oxo-3-[phenyl-(4-sulfamoylphenyl)methylidene]indol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[2-oxo-3-[phenyl-(4-sulfamoylphenyl)methylidene]indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 76701304 |
| Molecular Formula | C30H24N2O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | methyl 3-[[2-oxo-3-[phenyl-(4-sulfamoylphenyl)methylidene]indol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2C(=O)C(=C(c3ccccc3)c3ccc(S(N)(=O)=O)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C30H24N2O5S/c1-37-30(34)23-11-7-8-20(18-23)19-32-26-13-6-5-12-25(26)28(29(32)33)27(21-9-3-2-4-10-21)22-14-16-24(17-15-22)38(31,35)36/h2-18H,19H2,1H3,(H2,31,35,36) |
| InChIKey | QBMOKYRTRFKHMD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|