C31H24F3NO3 — CID 123536980
1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-3-[phenyl-[3-(trifluoromethyl)phenyl]methylidene]indol-2-one (PubChem CID 123536980) has the molecular formula C31H24F3NO3 and a molecular weight of 515.53 g/mol. Its IUPAC name is 1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-3-[phenyl-[3-(trifluoromethyl)phenyl]methylidene]indol-2-one.
| Compound Name | 1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-3-[phenyl-[3-(trifluoromethyl)phenyl]methylidene]indol-2-one |
|---|---|
| PubChem CID | 123536980 |
| Molecular Formula | C31H24F3NO3 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-3-[phenyl-[3-(trifluoromethyl)phenyl]methylidene]indol-2-one |
| SMILES | COC(O)c1cccc(CN2C(=O)C(=C(c3ccccc3)c3cccc(C(F)(F)F)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C31H24F3NO3/c1-38-30(37)23-13-7-9-20(17-23)19-35-26-16-6-5-15-25(26)28(29(35)36)27(21-10-3-2-4-11-21)22-12-8-14-24(18-22)31(32,33)34/h2-18,30,37H,19H2,1H3 |
| InChIKey | RYEJHBOJMXCSTL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|