C27H19ClN2O3S — CID 67036301
methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 67036301) has the molecular formula C27H19ClN2O3S and a molecular weight of 486.98 g/mol. Its IUPAC name is methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 67036301 |
| Molecular Formula | C27H19ClN2O3S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(CN2C(=O)/C(=C(\c3ccccc3)c3ccc(Cl)cc3)c3ccccc32)n1 |
| InChI | InChI=1S/C27H19ClN2O3S/c1-33-27(32)21-16-34-23(29-21)15-30-22-10-6-5-9-20(22)25(26(30)31)24(17-7-3-2-4-8-17)18-11-13-19(28)14-12-18/h2-14,16H,15H2,1H3/b25-24+ |
| InChIKey | MFYKAUNXUAAYRQ-OCOZRVBESA-N |
| XLogP | 6.09 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|